There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 100 g | ||
| 250 g | ||
| 500 g | ||
| 1 kg |
| CAS | 89250-26-0 |
| Synonyms | 89250-26-0; Astragalus polysaccharide; 2-(chloromethyl)-4-(4-nitrophenyl)-1,3-thiazole; 2-(Chloromethyl)-4-(4-nitrophenyl)thiazole |
| Formula | C10H7ClN2O2S |
| MW | 254.69 |
| MDL No. | MFCD02180551 |
| InChI | InChI=1S/C10H7ClN2O2S/c11-5-10-12-9(6-16-10)7-1-3-8(4-2-7)13(14)15/h1-4,6H,5H2 |
| InChI Key | LEBRGKZHLICZCZ-UHFFFAOYSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |