There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 5 mg | ||
| 10 mg |
| CAS | 6215-96-9 |
| Synonyms | Neocarrabiose; 3-O-(3,6-Anhydro-alpha-D-galactopyranosyl)-beta-D-galactopyranose; 6215-96-9 |
| Formula | C12H20O10 |
| MW | 324.28 |
| MDL No. | MFCD05864986 |
| InChI | InChI=1S/C12H20O10/c13-1-3-5(14)10(7(16)11(18)20-3)22-12-8(17)9-6(15)4(21-12)2-19-9/h3-18H,1-2H2/t3-,4-,5+,6?,7-,8-,9+,10+,11?,12-/m1/s1 |
| InChI Key | JWMBOBQNPBCYER-LNSPREKNSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |