There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| 100 g | ||
| 250 g | ||
| 500 g | ||
| 1 kg |
| CAS | 9004-57-3 |
| Synonyms | 9004-57-3; 4-O-[3-Deoxy-3-(ethoxymethyl)-6-O-ethyl-beta-D-glucopyranosyl]-2-O-ethyl-beta-D-glucopyranose |
| Formula | C19H36O11 |
| MW | 440.5 |
| MDL No. | MFCD00131037 |
| InChI | InChI=1S/C19H36O11/c1-4-25-8-10-13(21)12(9-26-5-2)29-19(14(10)22)30-16-11(7-20)28-18(24)17(15(16)23)27-6-3/h10-24H,4-9H2,1-3H3/t10-,11+,12+,13-,14+,15-,16+,17+,18+,19-/m0/s1 |
| InChI Key | GJQHNBFXPPDVQM-KSQRYXQLSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |