There is no product in the shopping cart, buy it!
| Size | Qty | Add To Basket |
|---|---|---|
| Inquiry |
| CAS | 172945-26-5 |
| Synonyms | 172945-26-5; C20H33NO9; SCHEMBL20516515; Hexyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-beta-D-glucopyranoside; ZINC12660321 |
| Formula | C20H33NO9 |
| MW | 431.48 |
| MDL No. | MFCD08703747 |
| InChI | InChI=1S/C20H33NO9/c1-6-7-8-9-10-26-20-17(21-12(2)22)19(29-15(5)25)18(28-14(4)24)16(30-20)11-27-13(3)23/h16-20H,6-11H2,1-5H3,(H,21,22)/t16-,17-,18-,19-,20-/m1/s1 |
| InChI Key | RZSSLCQNNAGTQY-LASHMREHSA-N |
| Purity | Min. 95% |
| Form | Dried by centrifugal evaporation from an aqueous solution. |
| Identity | Conforms to structure |
| Storage | Store at -20°C for long term storage. |